C27H32ClN5O5 — CID 69033055
[(19S)-8-amino-10-[3-(dimethylamino)propylamino]-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] acetate;hydrochloride (PubChem CID 69033055) has the molecular formula C27H32ClN5O5 and a molecular weight of 542.04 g/mol. Its IUPAC name is [(19S)-8-amino-10-[3-(dimethylamino)propylamino]-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] acetate;hydrochloride.
| Compound Name | [(19S)-8-amino-10-[3-(dimethylamino)propylamino]-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] acetate;hydrochloride |
|---|---|
| PubChem CID | 69033055 |
| Molecular Formula | C27H32ClN5O5 |
| Molecular Weight | 542.04 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | [(19S)-8-amino-10-[3-(dimethylamino)propylamino]-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] acetate;hydrochloride |
| SMILES | CC[C@@]1(OC(C)=O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cccc(N)c1c2NCCCN(C)C.Cl |
| InChI | InChI=1S/C27H31N5O5.ClH/c1-5-27(37-15(2)33)18-12-21-23-16(13-32(21)25(34)17(18)14-36-26(27)35)24(29-10-7-11-31(3)4)22-19(28)8-6-9-20(22)30-23;/h6,8-9,12H,5,7,10-11,13-14,28H2,1-4H3,(H,29,30);1H/t27-;/m0./s1 |
| InChIKey | RSXIUGCLDJPEGO-YCBFMBTMSA-N |
| XLogP | 3.02 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.04 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|