C27H29N5O7 — CID 69034401
[(19S)-10-[3-(dimethylamino)propylamino]-19-ethyl-8-nitro-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] acetate (PubChem CID 69034401) has the molecular formula C27H29N5O7 and a molecular weight of 535.56 g/mol. Its IUPAC name is [(19S)-10-[3-(dimethylamino)propylamino]-19-ethyl-8-nitro-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] acetate.
| Compound Name | [(19S)-10-[3-(dimethylamino)propylamino]-19-ethyl-8-nitro-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] acetate |
|---|---|
| PubChem CID | 69034401 |
| Molecular Formula | C27H29N5O7 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | [(19S)-10-[3-(dimethylamino)propylamino]-19-ethyl-8-nitro-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] acetate |
| SMILES | CC[C@@]1(OC(C)=O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cccc([N+](=O)[O-])c1c2NCCCN(C)C |
| InChI | InChI=1S/C27H29N5O7/c1-5-27(39-15(2)33)18-12-21-23-16(13-31(21)25(34)17(18)14-38-26(27)35)24(28-10-7-11-30(3)4)22-19(29-23)8-6-9-20(22)32(36)37/h6,8-9,12H,5,7,10-11,13-14H2,1-4H3,(H,28,29)/t27-/m0/s1 |
| InChIKey | BGHNAQKFRPIOHR-MHZLTWQESA-N |
| XLogP | 2.92 |
| TPSA | 145.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|