C19H20ClF3N2O — CID 69039484
N-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-N'-ethyl-N-methylmethanimidamide (PubChem CID 69039484) has the molecular formula C19H20ClF3N2O and a molecular weight of 384.83 g/mol. Its IUPAC name is N-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-N'-ethyl-N-methylmethanimidamide.
| Compound Name | N-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-N'-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 69039484 |
| Molecular Formula | C19H20ClF3N2O |
| Molecular Weight | 384.83 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | N-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-N'-ethyl-N-methylmethanimidamide |
| SMILES | CC/N=C/N(C)c1cc(C)c(Oc2ccc(Cl)c(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C19H20ClF3N2O/c1-5-24-11-25(4)17-8-13(3)18(9-12(17)2)26-14-6-7-16(20)15(10-14)19(21,22)23/h6-11H,5H2,1-4H3/b24-11+ |
| InChIKey | SZYBOMUAWKSTLY-BHGWPJFGSA-N |
| XLogP | 6.25 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.83 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|