C22H30N4O2S — CID 69042843
2-methyl-3-[(2R)-1-(4-methylsulfonylphenyl)-4-piperidin-4-ylpiperidin-2-yl]pyrazine (PubChem CID 69042843) has the molecular formula C22H30N4O2S and a molecular weight of 414.58 g/mol. Its IUPAC name is 2-methyl-3-[(2R)-1-(4-methylsulfonylphenyl)-4-piperidin-4-ylpiperidin-2-yl]pyrazine.
| Compound Name | 2-methyl-3-[(2R)-1-(4-methylsulfonylphenyl)-4-piperidin-4-ylpiperidin-2-yl]pyrazine |
|---|---|
| PubChem CID | 69042843 |
| Molecular Formula | C22H30N4O2S |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 2-methyl-3-[(2R)-1-(4-methylsulfonylphenyl)-4-piperidin-4-ylpiperidin-2-yl]pyrazine |
| SMILES | Cc1nccnc1[C@H]1CC(C2CCNCC2)CCN1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H30N4O2S/c1-16-22(25-13-12-24-16)21-15-18(17-7-10-23-11-8-17)9-14-26(21)19-3-5-20(6-4-19)29(2,27)28/h3-6,12-13,17-18,21,23H,7-11,14-15H2,1-2H3/t18?,21-/m1/s1 |
| InChIKey | USNYCTSLCQICOM-BDPMCISCSA-N |
| XLogP | 3.15 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |