C11H15FN4O2 — CID 69043410
[1-(3-amino-4-pyridinyl)-5-fluoropiperidin-3-yl]carbamic acid (PubChem CID 69043410) has the molecular formula C11H15FN4O2 and a molecular weight of 254.26 g/mol. Its IUPAC name is [1-(3-amino-4-pyridinyl)-5-fluoropiperidin-3-yl]carbamic acid.
| Compound Name | [1-(3-amino-4-pyridinyl)-5-fluoropiperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 69043410 |
| Molecular Formula | C11H15FN4O2 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | [1-(3-amino-4-pyridinyl)-5-fluoropiperidin-3-yl]carbamic acid |
| SMILES | Nc1cnccc1N1CC(F)CC(NC(=O)O)C1 |
| InChI | InChI=1S/C11H15FN4O2/c12-7-3-8(15-11(17)18)6-16(5-7)10-1-2-14-4-9(10)13/h1-2,4,7-8,15H,3,5-6,13H2,(H,17,18) |
| InChIKey | RZLGKFRTIAITEW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |