C30H26N4O4S — CID 6904678
(E)-4-(4-methoxyphenyl)-3-[(E)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-N-(4-propan-2-ylphenyl)-1,3-thiazol-2-imine (PubChem CID 6904678) has the molecular formula C30H26N4O4S and a molecular weight of 538.63 g/mol. Its IUPAC name is (E)-4-(4-methoxyphenyl)-3-[(E)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-N-(4-propan-2-ylphenyl)-1,3-thiazol-2-imine.
| Compound Name | (E)-4-(4-methoxyphenyl)-3-[(E)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-N-(4-propan-2-ylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 6904678 |
| Molecular Formula | C30H26N4O4S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | (E)-4-(4-methoxyphenyl)-3-[(E)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-N-(4-propan-2-ylphenyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(-c2cs/c(=N\c3ccc(C(C)C)cc3)n2/N=C/c2ccc(-c3cccc([N+](=O)[O-])c3)o2)cc1 |
| InChI | InChI=1S/C30H26N4O4S/c1-20(2)21-7-11-24(12-8-21)32-30-33(28(19-39-30)22-9-13-26(37-3)14-10-22)31-18-27-15-16-29(38-27)23-5-4-6-25(17-23)34(35)36/h4-20H,1-3H3/b31-18+,32-30- |
| InChIKey | IHVBLIWRQJOAJP-GJNYFUJQSA-N |
| XLogP | 7.63 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|