C15H16N4O3 — CID 69052470
[2-[(2-amino-3-pyridinyl)amino]acetyl]-benzylcarbamic acid (PubChem CID 69052470) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is [2-[(2-amino-3-pyridinyl)amino]acetyl]-benzylcarbamic acid.
| Compound Name | [2-[(2-amino-3-pyridinyl)amino]acetyl]-benzylcarbamic acid |
|---|---|
| PubChem CID | 69052470 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | [2-[(2-amino-3-pyridinyl)amino]acetyl]-benzylcarbamic acid |
| SMILES | Nc1ncccc1NCC(=O)N(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H16N4O3/c16-14-12(7-4-8-17-14)18-9-13(20)19(15(21)22)10-11-5-2-1-3-6-11/h1-8,18H,9-10H2,(H2,16,17)(H,21,22) |
| InChIKey | LTVYHNZMBGLCKJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |