C32H39N7O5 — CID 69052643
methyl 2-[4-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-[2-(1,4-dihydroisoindol-2-yl)acetyl]amino]methyl]phenyl]acetate (PubChem CID 69052643) has the molecular formula C32H39N7O5 and a molecular weight of 601.71 g/mol. Its IUPAC name is methyl 2-[4-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-[2-(1,4-dihydroisoindol-2-yl)acetyl]amino]methyl]phenyl]acetate.
| Compound Name | methyl 2-[4-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-[2-(1,4-dihydroisoindol-2-yl)acetyl]amino]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 69052643 |
| Molecular Formula | C32H39N7O5 |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | methyl 2-[4-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-[2-(1,4-dihydroisoindol-2-yl)acetyl]amino]methyl]phenyl]acetate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCN(Cc3ccc(CC(=O)OC)cc3)C(=O)CN3C=C4CC=CC=C4C3)c2n1 |
| InChI | InChI=1S/C32H39N7O5/c1-3-4-16-44-31-35-29(33)28-30(36-31)39(32(42)34-28)15-7-14-38(18-23-12-10-22(11-13-23)17-27(41)43-2)26(40)21-37-19-24-8-5-6-9-25(24)20-37/h5-6,8,10-13,20H,3-4,7,9,14-19,21H2,1-2H3,(H,34,42)(H2,33,35,36) |
| InChIKey | WNWCYSVPJJMSRN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|