C23H31FIN5O2S — CID 69071693
N-[2-[2-(ethylamino)ethylamino]ethyl]-2-(2-fluoro-4-iodoanilino)-5,5-dimethyl-8-oxo-6,7-dihydro-4H-thieno[2,3-c]azepine-3-carboxamide (PubChem CID 69071693) has the molecular formula C23H31FIN5O2S and a molecular weight of 587.50 g/mol. Its IUPAC name is N-[2-[2-(ethylamino)ethylamino]ethyl]-2-(2-fluoro-4-iodoanilino)-5,5-dimethyl-8-oxo-6,7-dihydro-4H-thieno[2,3-c]azepine-3-carboxamide.
| Compound Name | N-[2-[2-(ethylamino)ethylamino]ethyl]-2-(2-fluoro-4-iodoanilino)-5,5-dimethyl-8-oxo-6,7-dihydro-4H-thieno[2,3-c]azepine-3-carboxamide |
|---|---|
| PubChem CID | 69071693 |
| Molecular Formula | C23H31FIN5O2S |
| Molecular Weight | 587.50 g/mol |
| Exact Mass | 587.12 |
| IUPAC Name | N-[2-[2-(ethylamino)ethylamino]ethyl]-2-(2-fluoro-4-iodoanilino)-5,5-dimethyl-8-oxo-6,7-dihydro-4H-thieno[2,3-c]azepine-3-carboxamide |
| SMILES | CCNCCNCCNC(=O)c1c(Nc2ccc(I)cc2F)sc2c1CC(C)(C)CNC2=O |
| InChI | InChI=1S/C23H31FIN5O2S/c1-4-26-7-8-27-9-10-28-20(31)18-15-12-23(2,3)13-29-21(32)19(15)33-22(18)30-17-6-5-14(25)11-16(17)24/h5-6,11,26-27,30H,4,7-10,12-13H2,1-3H3,(H,28,31)(H,29,32) |
| InChIKey | FZZAUNRHJCAQCD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|