C11H17NO2 — CID 69080264
(Z)-1-amino-1-(4-ethoxycyclohexa-2,4-dien-1-yl)prop-1-en-2-ol (PubChem CID 69080264) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (Z)-1-amino-1-(4-ethoxycyclohexa-2,4-dien-1-yl)prop-1-en-2-ol.
| Compound Name | (Z)-1-amino-1-(4-ethoxycyclohexa-2,4-dien-1-yl)prop-1-en-2-ol |
|---|---|
| PubChem CID | 69080264 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (Z)-1-amino-1-(4-ethoxycyclohexa-2,4-dien-1-yl)prop-1-en-2-ol |
| SMILES | CCOC1=CCC(/C(N)=C(\C)O)C=C1 |
| InChI | InChI=1S/C11H17NO2/c1-3-14-10-6-4-9(5-7-10)11(12)8(2)13/h4,6-7,9,13H,3,5,12H2,1-2H3/b11-8- |
| InChIKey | QPSYBFHOUCHBSV-FLIBITNWSA-N |
| XLogP | 2.23 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|