C13H19NO — CID 142518700
(E,4Z)-3-methoxy-4-(6-methylcyclohexa-2,4-dien-1-ylidene)pent-2-en-2-amine (PubChem CID 142518700) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (E,4Z)-3-methoxy-4-(6-methylcyclohexa-2,4-dien-1-ylidene)pent-2-en-2-amine.
| Compound Name | (E,4Z)-3-methoxy-4-(6-methylcyclohexa-2,4-dien-1-ylidene)pent-2-en-2-amine |
|---|---|
| PubChem CID | 142518700 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (E,4Z)-3-methoxy-4-(6-methylcyclohexa-2,4-dien-1-ylidene)pent-2-en-2-amine |
| SMILES | COC(=C(\C)N)/C(C)=C1/C=CC=CC1C |
| InChI | InChI=1S/C13H19NO/c1-9-7-5-6-8-12(9)10(2)13(15-4)11(3)14/h5-9H,14H2,1-4H3/b12-10-,13-11+ |
| InChIKey | YZSPGXBTXUHZNW-PJABCKPXSA-N |
| XLogP | 2.90 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|