C19H32N2 — CID 69081335
2-hept-4-enyl-4-(4-methylpentan-2-yl)benzene-1,3-diamine (PubChem CID 69081335) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 2-hept-4-enyl-4-(4-methylpentan-2-yl)benzene-1,3-diamine.
| Compound Name | 2-hept-4-enyl-4-(4-methylpentan-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 69081335 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | 2-hept-4-enyl-4-(4-methylpentan-2-yl)benzene-1,3-diamine |
| SMILES | CCC=CCCCc1c(N)ccc(C(C)CC(C)C)c1N |
| InChI | InChI=1S/C19H32N2/c1-5-6-7-8-9-10-17-18(20)12-11-16(19(17)21)15(4)13-14(2)3/h6-7,11-12,14-15H,5,8-10,13,20-21H2,1-4H3 |
| InChIKey | QEAOTOQKZUBADG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|