C12H19N3O4 — CID 69082521
methyl 5-amino-5-(4,6-dimethoxypyrimidin-5-yl)pentanoate (PubChem CID 69082521) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl 5-amino-5-(4,6-dimethoxypyrimidin-5-yl)pentanoate.
| Compound Name | methyl 5-amino-5-(4,6-dimethoxypyrimidin-5-yl)pentanoate |
|---|---|
| PubChem CID | 69082521 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | methyl 5-amino-5-(4,6-dimethoxypyrimidin-5-yl)pentanoate |
| SMILES | COC(=O)CCCC(N)c1c(OC)ncnc1OC |
| InChI | InChI=1S/C12H19N3O4/c1-17-9(16)6-4-5-8(13)10-11(18-2)14-7-15-12(10)19-3/h7-8H,4-6,13H2,1-3H3 |
| InChIKey | OHXZGWWZMJNDDN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 96.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |