C25H38ClNO3 — CID 69084162
4-[2-[1-[4-(1-butylcyclobutyl)-1-hydroxybutyl]-3-chloropyrrolidin-2-yl]ethyl]benzoic acid (PubChem CID 69084162) has the molecular formula C25H38ClNO3 and a molecular weight of 436.04 g/mol. Its IUPAC name is 4-[2-[1-[4-(1-butylcyclobutyl)-1-hydroxybutyl]-3-chloropyrrolidin-2-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[1-[4-(1-butylcyclobutyl)-1-hydroxybutyl]-3-chloropyrrolidin-2-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 69084162 |
| Molecular Formula | C25H38ClNO3 |
| Molecular Weight | 436.04 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 4-[2-[1-[4-(1-butylcyclobutyl)-1-hydroxybutyl]-3-chloropyrrolidin-2-yl]ethyl]benzoic acid |
| SMILES | CCCCC1(CCCC(O)N2CCC(Cl)C2CCc2ccc(C(=O)O)cc2)CCC1 |
| InChI | InChI=1S/C25H38ClNO3/c1-2-3-14-25(16-5-17-25)15-4-6-23(28)27-18-13-21(26)22(27)12-9-19-7-10-20(11-8-19)24(29)30/h7-8,10-11,21-23,28H,2-6,9,12-18H2,1H3,(H,29,30) |
| InChIKey | DJWWDHJLEUGEJQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.04 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|