C23H23F2N3O — CID 69084666
3-amino-4-[(3,4-difluorophenyl)methylamino]-N-[(1R)-1-phenylpropyl]benzamide (PubChem CID 69084666) has the molecular formula C23H23F2N3O and a molecular weight of 395.45 g/mol. Its IUPAC name is 3-amino-4-[(3,4-difluorophenyl)methylamino]-N-[(1R)-1-phenylpropyl]benzamide.
| Compound Name | 3-amino-4-[(3,4-difluorophenyl)methylamino]-N-[(1R)-1-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 69084666 |
| Molecular Formula | C23H23F2N3O |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 3-amino-4-[(3,4-difluorophenyl)methylamino]-N-[(1R)-1-phenylpropyl]benzamide |
| SMILES | CC[C@@H](NC(=O)c1ccc(NCc2ccc(F)c(F)c2)c(N)c1)c1ccccc1 |
| InChI | InChI=1S/C23H23F2N3O/c1-2-21(16-6-4-3-5-7-16)28-23(29)17-9-11-22(20(26)13-17)27-14-15-8-10-18(24)19(25)12-15/h3-13,21,27H,2,14,26H2,1H3,(H,28,29)/t21-/m1/s1 |
| InChIKey | UKHHSNIMPKQOJE-OAQYLSRUSA-N |
| XLogP | 5.04 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|