C23H21Cl2N3O3 — CID 70261617
4-[(2,6-dichlorophenyl)methylamino]-3-nitro-N-[(1R)-1-phenylpropyl]benzamide (PubChem CID 70261617) has the molecular formula C23H21Cl2N3O3 and a molecular weight of 458.35 g/mol. Its IUPAC name is 4-[(2,6-dichlorophenyl)methylamino]-3-nitro-N-[(1R)-1-phenylpropyl]benzamide.
| Compound Name | 4-[(2,6-dichlorophenyl)methylamino]-3-nitro-N-[(1R)-1-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 70261617 |
| Molecular Formula | C23H21Cl2N3O3 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 4-[(2,6-dichlorophenyl)methylamino]-3-nitro-N-[(1R)-1-phenylpropyl]benzamide |
| SMILES | CC[C@@H](NC(=O)c1ccc(NCc2c(Cl)cccc2Cl)c([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C23H21Cl2N3O3/c1-2-20(15-7-4-3-5-8-15)27-23(29)16-11-12-21(22(13-16)28(30)31)26-14-17-18(24)9-6-10-19(17)25/h3-13,20,26H,2,14H2,1H3,(H,27,29)/t20-/m1/s1 |
| InChIKey | UYXKUMBAWZDVQQ-HXUWFJFHSA-N |
| XLogP | 6.39 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|