C20H28N2O7 — CID 69088066
1-O-tert-butyl 3-O-methyl 6-(6-methoxy-3-methoxycarbonyl-2-pyridinyl)piperidine-1,3-dicarboxylate (PubChem CID 69088066) has the molecular formula C20H28N2O7 and a molecular weight of 408.45 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl 6-(6-methoxy-3-methoxycarbonyl-2-pyridinyl)piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl 6-(6-methoxy-3-methoxycarbonyl-2-pyridinyl)piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 69088066 |
| Molecular Formula | C20H28N2O7 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl 6-(6-methoxy-3-methoxycarbonyl-2-pyridinyl)piperidine-1,3-dicarboxylate |
| SMILES | COC(=O)c1ccc(OC)nc1C1CCC(C(=O)OC)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H28N2O7/c1-20(2,3)29-19(25)22-11-12(17(23)27-5)7-9-14(22)16-13(18(24)28-6)8-10-15(21-16)26-4/h8,10,12,14H,7,9,11H2,1-6H3 |
| InChIKey | PTWYYYAEXATGBB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 104.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|