C16H20N2O4 — CID 69096323
2-[(2R,5S)-4-benzyl-1,5-dimethyl-3,6-dioxopiperazin-2-yl]propanoic acid (PubChem CID 69096323) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[(2R,5S)-4-benzyl-1,5-dimethyl-3,6-dioxopiperazin-2-yl]propanoic acid.
| Compound Name | 2-[(2R,5S)-4-benzyl-1,5-dimethyl-3,6-dioxopiperazin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 69096323 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-[(2R,5S)-4-benzyl-1,5-dimethyl-3,6-dioxopiperazin-2-yl]propanoic acid |
| SMILES | CC(C(=O)O)[C@@H]1C(=O)N(Cc2ccccc2)[C@@H](C)C(=O)N1C |
| InChI | InChI=1S/C16H20N2O4/c1-10(16(21)22)13-15(20)18(11(2)14(19)17(13)3)9-12-7-5-4-6-8-12/h4-8,10-11,13H,9H2,1-3H3,(H,21,22)/t10?,11-,13+/m0/s1 |
| InChIKey | RLEMGNSHMIMIIE-QMDRTORHSA-N |
| XLogP | 0.96 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |