C22H27NO4 — CID 69097032
tert-butyl N-[2-[2-(3-ethylphenyl)-2-oxoethyl]-5-methoxyphenyl]carbamate (PubChem CID 69097032) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(3-ethylphenyl)-2-oxoethyl]-5-methoxyphenyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(3-ethylphenyl)-2-oxoethyl]-5-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 69097032 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | tert-butyl N-[2-[2-(3-ethylphenyl)-2-oxoethyl]-5-methoxyphenyl]carbamate |
| SMILES | CCc1cccc(C(=O)Cc2ccc(OC)cc2NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C22H27NO4/c1-6-15-8-7-9-17(12-15)20(24)13-16-10-11-18(26-5)14-19(16)23-21(25)27-22(2,3)4/h7-12,14H,6,13H2,1-5H3,(H,23,25) |
| InChIKey | POAHSYJLXCYCGO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |