C22H31ClN4O2S — CID 69099544
1-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]-5-oxohexyl]piperazin-2-one;hydrochloride (PubChem CID 69099544) has the molecular formula C22H31ClN4O2S and a molecular weight of 451.04 g/mol. Its IUPAC name is 1-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]-5-oxohexyl]piperazin-2-one;hydrochloride.
| Compound Name | 1-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]-5-oxohexyl]piperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 69099544 |
| Molecular Formula | C22H31ClN4O2S |
| Molecular Weight | 451.04 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 1-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]-5-oxohexyl]piperazin-2-one;hydrochloride |
| SMILES | CC(=O)C(CCCN1CCNCC1=O)N1CCN(c2cccc3sccc23)CC1.Cl |
| InChI | InChI=1S/C22H30N4O2S.ClH/c1-17(27)19(5-3-9-26-10-8-23-16-22(26)28)24-11-13-25(14-12-24)20-4-2-6-21-18(20)7-15-29-21;/h2,4,6-7,15,19,23H,3,5,8-14,16H2,1H3;1H |
| InChIKey | QSNKOPIRHDSUIT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.04 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |