C30H28F4N4O7 — CID 69109274
(3R)-3-[[2-[amino(isoquinolin-6-yl)amino]-2-(3,4-dimethoxyphenyl)acetyl]amino]-3-(2-fluorophenyl)propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 69109274) has the molecular formula C30H28F4N4O7 and a molecular weight of 632.57 g/mol. Its IUPAC name is (3R)-3-[[2-[amino(isoquinolin-6-yl)amino]-2-(3,4-dimethoxyphenyl)acetyl]amino]-3-(2-fluorophenyl)propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (3R)-3-[[2-[amino(isoquinolin-6-yl)amino]-2-(3,4-dimethoxyphenyl)acetyl]amino]-3-(2-fluorophenyl)propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69109274 |
| Molecular Formula | C30H28F4N4O7 |
| Molecular Weight | 632.57 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | (3R)-3-[[2-[amino(isoquinolin-6-yl)amino]-2-(3,4-dimethoxyphenyl)acetyl]amino]-3-(2-fluorophenyl)propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(C(C(=O)N[C@H](CC(=O)O)c2ccccc2F)N(N)c2ccc3cnccc3c2)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H27FN4O5.C2HF3O2/c1-37-24-10-8-18(14-25(24)38-2)27(33(30)20-9-7-19-16-31-12-11-17(19)13-20)28(36)32-23(15-26(34)35)21-5-3-4-6-22(21)29;3-2(4,5)1(6)7/h3-14,16,23,27H,15,30H2,1-2H3,(H,32,36)(H,34,35);(H,6,7)/t23-,27?;/m1./s1 |
| InChIKey | BNRSHHJZPWKWQZ-HGCNFWGTSA-N |
| XLogP | 4.78 |
| TPSA | 164.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|