C35H40F3N5O8S — CID 69108877
N-[(5-acetamido-2-ethylsulfonylphenyl)methyl]-2-[amino(isoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 69108877) has the molecular formula C35H40F3N5O8S and a molecular weight of 747.79 g/mol. Its IUPAC name is N-[(5-acetamido-2-ethylsulfonylphenyl)methyl]-2-[amino(isoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(5-acetamido-2-ethylsulfonylphenyl)methyl]-2-[amino(isoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69108877 |
| Molecular Formula | C35H40F3N5O8S |
| Molecular Weight | 747.79 g/mol |
| Exact Mass | 747.25 |
| IUPAC Name | N-[(5-acetamido-2-ethylsulfonylphenyl)methyl]-2-[amino(isoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | CCOc1cc(C(C(=O)NCc2cc(NC(C)=O)ccc2S(=O)(=O)CC)N(N)c2ccc3cnccc3c2)ccc1OC(C)C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C33H39N5O6S.C2HF3O2/c1-6-43-30-18-24(9-12-29(30)44-21(3)4)32(38(34)28-11-8-25-19-35-15-14-23(25)17-28)33(40)36-20-26-16-27(37-22(5)39)10-13-31(26)45(41,42)7-2;3-2(4,5)1(6)7/h8-19,21,32H,6-7,20,34H2,1-5H3,(H,36,40)(H,37,39);(H,6,7) |
| InChIKey | RZYQRRBPVLVEFP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 190.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.79 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|