C36H42N4O7S — CID 69469377
1-[2-[amino(isoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetyl]-2-(2-propan-2-ylsulfonylphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 69469377) has the molecular formula C36H42N4O7S and a molecular weight of 674.82 g/mol. Its IUPAC name is 1-[2-[amino(isoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetyl]-2-(2-propan-2-ylsulfonylphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-[amino(isoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetyl]-2-(2-propan-2-ylsulfonylphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 69469377 |
| Molecular Formula | C36H42N4O7S |
| Molecular Weight | 674.82 g/mol |
| Exact Mass | 674.28 |
| IUPAC Name | 1-[2-[amino(isoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetyl]-2-(2-propan-2-ylsulfonylphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCOc1cc(C(C(=O)N2CCC(C(=O)O)C2c2ccccc2S(=O)(=O)C(C)C)N(N)c2ccc3cnccc3c2)ccc1OC(C)C |
| InChI | InChI=1S/C36H42N4O7S/c1-6-46-31-20-25(12-14-30(31)47-22(2)3)33(40(37)27-13-11-26-21-38-17-15-24(26)19-27)35(41)39-18-16-29(36(42)43)34(39)28-9-7-8-10-32(28)48(44,45)23(4)5/h7-15,17,19-23,29,33-34H,6,16,18,37H2,1-5H3,(H,42,43) |
| InChIKey | NTBMMQMQBSUBKP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.82 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|