C32H35F3N4O5 — CID 69108897
(2R)-2-[amino(isoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)-N-(2-phenylethyl)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 69108897) has the molecular formula C32H35F3N4O5 and a molecular weight of 612.65 g/mol. Its IUPAC name is (2R)-2-[amino(isoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)-N-(2-phenylethyl)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R)-2-[amino(isoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)-N-(2-phenylethyl)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69108897 |
| Molecular Formula | C32H35F3N4O5 |
| Molecular Weight | 612.65 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | (2R)-2-[amino(isoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)-N-(2-phenylethyl)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | CCOc1cc([C@H](C(=O)NCCc2ccccc2)N(N)c2ccc3cnccc3c2)ccc1OC(C)C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H34N4O3.C2HF3O2/c1-4-36-28-19-24(11-13-27(28)37-21(2)3)29(30(35)33-17-14-22-8-6-5-7-9-22)34(31)26-12-10-25-20-32-16-15-23(25)18-26;3-2(4,5)1(6)7/h5-13,15-16,18-21,29H,4,14,17,31H2,1-3H3,(H,33,35);(H,6,7)/t29-;/m1./s1 |
| InChIKey | DCLPXCCSMFYFKI-XXIQNXCHSA-N |
| XLogP | 5.83 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.65 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|