C32H32F3N5O8 — CID 69109286
3-(3-acetamidophenyl)-3-[[(2R)-2-[amino(isoquinolin-6-yl)amino]-2-(3,4-dimethoxyphenyl)acetyl]amino]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 69109286) has the molecular formula C32H32F3N5O8 and a molecular weight of 671.63 g/mol. Its IUPAC name is 3-(3-acetamidophenyl)-3-[[(2R)-2-[amino(isoquinolin-6-yl)amino]-2-(3,4-dimethoxyphenyl)acetyl]amino]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(3-acetamidophenyl)-3-[[(2R)-2-[amino(isoquinolin-6-yl)amino]-2-(3,4-dimethoxyphenyl)acetyl]amino]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69109286 |
| Molecular Formula | C32H32F3N5O8 |
| Molecular Weight | 671.63 g/mol |
| Exact Mass | 671.22 |
| IUPAC Name | 3-(3-acetamidophenyl)-3-[[(2R)-2-[amino(isoquinolin-6-yl)amino]-2-(3,4-dimethoxyphenyl)acetyl]amino]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc([C@H](C(=O)NC(CC(=O)O)c2cccc(NC(C)=O)c2)N(N)c2ccc3cnccc3c2)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H31N5O6.C2HF3O2/c1-18(36)33-23-6-4-5-20(13-23)25(16-28(37)38)34-30(39)29(21-8-10-26(40-2)27(15-21)41-3)35(31)24-9-7-22-17-32-12-11-19(22)14-24;3-2(4,5)1(6)7/h4-15,17,25,29H,16,31H2,1-3H3,(H,33,36)(H,34,39)(H,37,38);(H,6,7)/t25?,29-;/m1./s1 |
| InChIKey | CSYULSRIGVGJSJ-BYNXYREKSA-N |
| XLogP | 4.60 |
| TPSA | 193.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|