C33H42FN3O8 — CID 69109580
methyl 2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-(8-fluoroisoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetate (PubChem CID 69109580) has the molecular formula C33H42FN3O8 and a molecular weight of 627.71 g/mol. Its IUPAC name is methyl 2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-(8-fluoroisoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetate.
| Compound Name | methyl 2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-(8-fluoroisoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetate |
|---|---|
| PubChem CID | 69109580 |
| Molecular Formula | C33H42FN3O8 |
| Molecular Weight | 627.71 g/mol |
| Exact Mass | 627.30 |
| IUPAC Name | methyl 2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-(8-fluoroisoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetate |
| SMILES | CCOc1cc(C(C(=O)OC)N(c2cc(F)c3cnccc3c2)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)ccc1OC(C)C |
| InChI | InChI=1S/C33H42FN3O8/c1-11-42-27-17-22(12-13-26(27)43-20(2)3)28(29(38)41-10)36(23-16-21-14-15-35-19-24(21)25(34)18-23)37(30(39)44-32(4,5)6)31(40)45-33(7,8)9/h12-20,28H,11H2,1-10H3 |
| InChIKey | VDNIJBIDUYWBHH-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 116.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.71 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|