C28H32FN3O6 — CID 69109603
2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-isoquinolin-6-ylamino]-2-(2-fluoro-5-methylphenyl)acetic acid (PubChem CID 69109603) has the molecular formula C28H32FN3O6 and a molecular weight of 525.58 g/mol. Its IUPAC name is 2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-isoquinolin-6-ylamino]-2-(2-fluoro-5-methylphenyl)acetic acid.
| Compound Name | 2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-isoquinolin-6-ylamino]-2-(2-fluoro-5-methylphenyl)acetic acid |
|---|---|
| PubChem CID | 69109603 |
| Molecular Formula | C28H32FN3O6 |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-isoquinolin-6-ylamino]-2-(2-fluoro-5-methylphenyl)acetic acid |
| SMILES | Cc1ccc(F)c(C(C(=O)O)N(c2ccc3cnccc3c2)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C28H32FN3O6/c1-17-8-11-22(29)21(14-17)23(24(33)34)31(20-10-9-19-16-30-13-12-18(19)15-20)32(25(35)37-27(2,3)4)26(36)38-28(5,6)7/h8-16,23H,1-7H3,(H,33,34) |
| InChIKey | YKFJOBZHNCQOEX-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 109.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|