C28H32BrN3O6 — CID 69132560
methyl 2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-isoquinolin-6-ylamino]-2-(3-bromophenyl)acetate (PubChem CID 69132560) has the molecular formula C28H32BrN3O6 and a molecular weight of 586.48 g/mol. Its IUPAC name is methyl 2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-isoquinolin-6-ylamino]-2-(3-bromophenyl)acetate.
| Compound Name | methyl 2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-isoquinolin-6-ylamino]-2-(3-bromophenyl)acetate |
|---|---|
| PubChem CID | 69132560 |
| Molecular Formula | C28H32BrN3O6 |
| Molecular Weight | 586.48 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | methyl 2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-isoquinolin-6-ylamino]-2-(3-bromophenyl)acetate |
| SMILES | COC(=O)C(c1cccc(Br)c1)N(c1ccc2cnccc2c1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H32BrN3O6/c1-27(2,3)37-25(34)32(26(35)38-28(4,5)6)31(22-12-11-20-17-30-14-13-18(20)16-22)23(24(33)36-7)19-9-8-10-21(29)15-19/h8-17,23H,1-7H3 |
| InChIKey | HXYWNMUYXMDOLS-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 98.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.48 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|