C39H43N5O8 — CID 69154268
2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-isoquinolin-6-ylamino]-2-[4-[2-[(3-cyanophenyl)carbamoyloxy]ethyl]-3-ethylphenyl]acetic acid (PubChem CID 69154268) has the molecular formula C39H43N5O8 and a molecular weight of 709.80 g/mol. Its IUPAC name is 2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-isoquinolin-6-ylamino]-2-[4-[2-[(3-cyanophenyl)carbamoyloxy]ethyl]-3-ethylphenyl]acetic acid.
| Compound Name | 2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-isoquinolin-6-ylamino]-2-[4-[2-[(3-cyanophenyl)carbamoyloxy]ethyl]-3-ethylphenyl]acetic acid |
|---|---|
| PubChem CID | 69154268 |
| Molecular Formula | C39H43N5O8 |
| Molecular Weight | 709.80 g/mol |
| Exact Mass | 709.31 |
| IUPAC Name | 2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-isoquinolin-6-ylamino]-2-[4-[2-[(3-cyanophenyl)carbamoyloxy]ethyl]-3-ethylphenyl]acetic acid |
| SMILES | CCc1cc(C(C(=O)O)N(c2ccc3cnccc3c2)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)ccc1CCOC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C39H43N5O8/c1-8-26-21-29(13-12-27(26)17-19-50-35(47)42-31-11-9-10-25(20-31)23-40)33(34(45)46)43(32-15-14-30-24-41-18-16-28(30)22-32)44(36(48)51-38(2,3)4)37(49)52-39(5,6)7/h9-16,18,20-22,24,33H,8,17,19H2,1-7H3,(H,42,47)(H,45,46) |
| InChIKey | LSKSGGQUUICTRS-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 171.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.80 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|