C20H22O6 — CID 69110649
3-(3-methoxyprop-1-enyl)-5-(3,4,5-trimethoxyphenyl)benzoic acid (PubChem CID 69110649) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is 3-(3-methoxyprop-1-enyl)-5-(3,4,5-trimethoxyphenyl)benzoic acid.
| Compound Name | 3-(3-methoxyprop-1-enyl)-5-(3,4,5-trimethoxyphenyl)benzoic acid |
|---|---|
| PubChem CID | 69110649 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 3-(3-methoxyprop-1-enyl)-5-(3,4,5-trimethoxyphenyl)benzoic acid |
| SMILES | COCC=Cc1cc(C(=O)O)cc(-c2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C20H22O6/c1-23-7-5-6-13-8-14(10-16(9-13)20(21)22)15-11-17(24-2)19(26-4)18(12-15)25-3/h5-6,8-12H,7H2,1-4H3,(H,21,22) |
| InChIKey | RSCDNBFKTNGVLF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |