C20H15FN2O5 — CID 69113262
9-amino-7-benzyl-2-fluoro-8-methyl-3,4-dioxopyrano[2,3-e]indole-2-carboxylic acid (PubChem CID 69113262) has the molecular formula C20H15FN2O5 and a molecular weight of 382.35 g/mol. Its IUPAC name is 9-amino-7-benzyl-2-fluoro-8-methyl-3,4-dioxopyrano[2,3-e]indole-2-carboxylic acid.
| Compound Name | 9-amino-7-benzyl-2-fluoro-8-methyl-3,4-dioxopyrano[2,3-e]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 69113262 |
| Molecular Formula | C20H15FN2O5 |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 9-amino-7-benzyl-2-fluoro-8-methyl-3,4-dioxopyrano[2,3-e]indole-2-carboxylic acid |
| SMILES | Cc1c(N)c2c3c(ccc2n1Cc1ccccc1)C(=O)C(=O)C(F)(C(=O)O)O3 |
| InChI | InChI=1S/C20H15FN2O5/c1-10-15(22)14-13(23(10)9-11-5-3-2-4-6-11)8-7-12-16(24)18(25)20(21,19(26)27)28-17(12)14/h2-8H,9,22H2,1H3,(H,26,27) |
| InChIKey | WLUPTGXABSYGNB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|