C16H13Cl3N2O3 — CID 69119733
methyl 3-[[N-chloro-C-(2,4-dichlorophenyl)carbonimidoyl]amino]-4-methoxybenzoate (PubChem CID 69119733) has the molecular formula C16H13Cl3N2O3 and a molecular weight of 387.65 g/mol. Its IUPAC name is methyl 3-[[N-chloro-C-(2,4-dichlorophenyl)carbonimidoyl]amino]-4-methoxybenzoate.
| Compound Name | methyl 3-[[N-chloro-C-(2,4-dichlorophenyl)carbonimidoyl]amino]-4-methoxybenzoate |
|---|---|
| PubChem CID | 69119733 |
| Molecular Formula | C16H13Cl3N2O3 |
| Molecular Weight | 387.65 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | methyl 3-[[N-chloro-C-(2,4-dichlorophenyl)carbonimidoyl]amino]-4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)c(NC(=NCl)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H13Cl3N2O3/c1-23-14-6-3-9(16(22)24-2)7-13(14)20-15(21-19)11-5-4-10(17)8-12(11)18/h3-8H,1-2H3,(H,20,21) |
| InChIKey | ORPBJGPDJAUPJI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|