C23H28ClN3O4 — CID 69123208
[4-chloro-3-[2-[2,6-dimethyl-4-(phenylcarbamoyl)piperazin-1-yl]ethoxy]phenyl] acetate (PubChem CID 69123208) has the molecular formula C23H28ClN3O4 and a molecular weight of 445.95 g/mol. Its IUPAC name is [4-chloro-3-[2-[2,6-dimethyl-4-(phenylcarbamoyl)piperazin-1-yl]ethoxy]phenyl] acetate.
| Compound Name | [4-chloro-3-[2-[2,6-dimethyl-4-(phenylcarbamoyl)piperazin-1-yl]ethoxy]phenyl] acetate |
|---|---|
| PubChem CID | 69123208 |
| Molecular Formula | C23H28ClN3O4 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | [4-chloro-3-[2-[2,6-dimethyl-4-(phenylcarbamoyl)piperazin-1-yl]ethoxy]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(Cl)c(OCCN2C(C)CN(C(=O)Nc3ccccc3)CC2C)c1 |
| InChI | InChI=1S/C23H28ClN3O4/c1-16-14-26(23(29)25-19-7-5-4-6-8-19)15-17(2)27(16)11-12-30-22-13-20(31-18(3)28)9-10-21(22)24/h4-10,13,16-17H,11-12,14-15H2,1-3H3,(H,25,29) |
| InChIKey | XMMMZMRSVFFIQT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|