C17H18F3N5 — CID 69129574
N-[(2R)-3,3-dimethylbutan-2-yl]-2-(2,4,6-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 69129574) has the molecular formula C17H18F3N5 and a molecular weight of 349.36 g/mol. Its IUPAC name is N-[(2R)-3,3-dimethylbutan-2-yl]-2-(2,4,6-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-[(2R)-3,3-dimethylbutan-2-yl]-2-(2,4,6-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 69129574 |
| Molecular Formula | C17H18F3N5 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-[(2R)-3,3-dimethylbutan-2-yl]-2-(2,4,6-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[C@@H](Nc1ccnc2nc(-c3c(F)cc(F)cc3F)nn12)C(C)(C)C |
| InChI | InChI=1S/C17H18F3N5/c1-9(17(2,3)4)22-13-5-6-21-16-23-15(24-25(13)16)14-11(19)7-10(18)8-12(14)20/h5-9,22H,1-4H3/t9-/m1/s1 |
| InChIKey | YVFUHHSQUJWGPW-SECBINFHSA-N |
| XLogP | 4.06 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |