C15H20F2N2O4 — CID 69129681
3-(2-methylpropoxycarbonylamino)propyl N-(3,4-difluorophenyl)carbamate (PubChem CID 69129681) has the molecular formula C15H20F2N2O4 and a molecular weight of 330.33 g/mol. Its IUPAC name is 3-(2-methylpropoxycarbonylamino)propyl N-(3,4-difluorophenyl)carbamate.
| Compound Name | 3-(2-methylpropoxycarbonylamino)propyl N-(3,4-difluorophenyl)carbamate |
|---|---|
| PubChem CID | 69129681 |
| Molecular Formula | C15H20F2N2O4 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 3-(2-methylpropoxycarbonylamino)propyl N-(3,4-difluorophenyl)carbamate |
| SMILES | CC(C)COC(=O)NCCCOC(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H20F2N2O4/c1-10(2)9-23-14(20)18-6-3-7-22-15(21)19-11-4-5-12(16)13(17)8-11/h4-5,8,10H,3,6-7,9H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | CDNASXASSFUFGB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|