C28H45NO4 — CID 69132574
ethyl 2-[[(E)-octadec-11-en-2-yl]oxycarbonylamino]benzoate (PubChem CID 69132574) has the molecular formula C28H45NO4 and a molecular weight of 459.67 g/mol. Its IUPAC name is ethyl 2-[[(E)-octadec-11-en-2-yl]oxycarbonylamino]benzoate.
| Compound Name | ethyl 2-[[(E)-octadec-11-en-2-yl]oxycarbonylamino]benzoate |
|---|---|
| PubChem CID | 69132574 |
| Molecular Formula | C28H45NO4 |
| Molecular Weight | 459.67 g/mol |
| Exact Mass | 459.33 |
| IUPAC Name | ethyl 2-[[(E)-octadec-11-en-2-yl]oxycarbonylamino]benzoate |
| SMILES | CCCCCC/C=C/CCCCCCCCC(C)OC(=O)Nc1ccccc1C(=O)OCC |
| InChI | InChI=1S/C28H45NO4/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-21-24(3)33-28(31)29-26-23-20-19-22-25(26)27(30)32-5-2/h10-11,19-20,22-24H,4-9,12-18,21H2,1-3H3,(H,29,31)/b11-10+ |
| InChIKey | SNTMDKWAHWPXNM-ZHACJKMWSA-N |
| XLogP | 8.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.67 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|