C16H23NO5 — CID 19000976
2-hydroxy-6-(octan-2-yloxycarbonylamino)benzoic acid (PubChem CID 19000976) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is 2-hydroxy-6-(octan-2-yloxycarbonylamino)benzoic acid.
| Compound Name | 2-hydroxy-6-(octan-2-yloxycarbonylamino)benzoic acid |
|---|---|
| PubChem CID | 19000976 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-hydroxy-6-(octan-2-yloxycarbonylamino)benzoic acid |
| SMILES | CCCCCCC(C)OC(=O)Nc1cccc(O)c1C(=O)O |
| InChI | InChI=1S/C16H23NO5/c1-3-4-5-6-8-11(2)22-16(21)17-12-9-7-10-13(18)14(12)15(19)20/h7,9-11,18H,3-6,8H2,1-2H3,(H,17,21)(H,19,20) |
| InChIKey | MXBHITVSFPHXTC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|