C15H11N3O4S2 — CID 69139702
3-[4-(benzenesulfonyl)thiophen-3-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione (PubChem CID 69139702) has the molecular formula C15H11N3O4S2 and a molecular weight of 361.40 g/mol. Its IUPAC name is 3-[4-(benzenesulfonyl)thiophen-3-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione.
| Compound Name | 3-[4-(benzenesulfonyl)thiophen-3-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione |
|---|---|
| PubChem CID | 69139702 |
| Molecular Formula | C15H11N3O4S2 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 3-[4-(benzenesulfonyl)thiophen-3-yl]-1-(1H-1,2,4-triazol-5-yl)propane-1,2-dione |
| SMILES | O=C(Cc1cscc1S(=O)(=O)c1ccccc1)C(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C15H11N3O4S2/c19-12(14(20)15-16-9-17-18-15)6-10-7-23-8-13(10)24(21,22)11-4-2-1-3-5-11/h1-5,7-9H,6H2,(H,16,17,18) |
| InChIKey | FWHCCPGNBAWBTE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|