C6H3Cl3O — CID 6914
2,4,6-trichlorophenol (PubChem CID 6914) has the molecular formula C6H3Cl3O and a molecular weight of 197.45 g/mol. Its IUPAC name is 2,4,6-trichlorophenol.
| Compound Name | 2,4,6-trichlorophenol |
|---|---|
| PubChem CID | 6914 |
| Molecular Formula | C6H3Cl3O |
| Molecular Weight | 197.45 g/mol |
| Exact Mass | 195.92 |
| IUPAC Name | 2,4,6-trichlorophenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C6H3Cl3O/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H |
| InChIKey | LINPIYWFGCPVIE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |