C25H27N3O6 — CID 69143128
benzyl (4S)-5-[2-(2-acetamido-3-methoxy-3-oxoprop-1-enyl)-5-cyanophenoxy]-4-aminopentanoate (PubChem CID 69143128) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is benzyl (4S)-5-[2-(2-acetamido-3-methoxy-3-oxoprop-1-enyl)-5-cyanophenoxy]-4-aminopentanoate.
| Compound Name | benzyl (4S)-5-[2-(2-acetamido-3-methoxy-3-oxoprop-1-enyl)-5-cyanophenoxy]-4-aminopentanoate |
|---|---|
| PubChem CID | 69143128 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | benzyl (4S)-5-[2-(2-acetamido-3-methoxy-3-oxoprop-1-enyl)-5-cyanophenoxy]-4-aminopentanoate |
| SMILES | COC(=O)C(=Cc1ccc(C#N)cc1OC[C@@H](N)CCC(=O)OCc1ccccc1)NC(C)=O |
| InChI | InChI=1S/C25H27N3O6/c1-17(29)28-22(25(31)32-2)13-20-9-8-19(14-26)12-23(20)33-16-21(27)10-11-24(30)34-15-18-6-4-3-5-7-18/h3-9,12-13,21H,10-11,15-16,27H2,1-2H3,(H,28,29)/t21-/m0/s1 |
| InChIKey | XDINANKTAOCAAZ-NRFANRHFSA-N |
| XLogP | 2.44 |
| TPSA | 140.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|