C41H39F3N6O9 — CID 69142767
benzyl (4R)-5-[2-(2-acetamido-3-methoxy-3-oxoprop-1-enyl)-5-cyanophenoxy]-4-[[3-[4-(diaminomethylideneamino)phenyl]benzoyl]amino]pentanoate;2,2,2-trifluoroacetic acid (PubChem CID 69142767) has the molecular formula C41H39F3N6O9 and a molecular weight of 816.79 g/mol. Its IUPAC name is benzyl (4R)-5-[2-(2-acetamido-3-methoxy-3-oxoprop-1-enyl)-5-cyanophenoxy]-4-[[3-[4-(diaminomethylideneamino)phenyl]benzoyl]amino]pentanoate;2,2,2-trifluoroacetic acid.
| Compound Name | benzyl (4R)-5-[2-(2-acetamido-3-methoxy-3-oxoprop-1-enyl)-5-cyanophenoxy]-4-[[3-[4-(diaminomethylideneamino)phenyl]benzoyl]amino]pentanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69142767 |
| Molecular Formula | C41H39F3N6O9 |
| Molecular Weight | 816.79 g/mol |
| Exact Mass | 816.27 |
| IUPAC Name | benzyl (4R)-5-[2-(2-acetamido-3-methoxy-3-oxoprop-1-enyl)-5-cyanophenoxy]-4-[[3-[4-(diaminomethylideneamino)phenyl]benzoyl]amino]pentanoate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)C(=Cc1ccc(C#N)cc1OC[C@@H](CCC(=O)OCc1ccccc1)NC(=O)c1cccc(-c2ccc(N=C(N)N)cc2)c1)NC(C)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C39H38N6O7.C2HF3O2/c1-25(46)43-34(38(49)50-2)21-30-12-11-27(22-40)19-35(30)51-24-33(17-18-36(47)52-23-26-7-4-3-5-8-26)44-37(48)31-10-6-9-29(20-31)28-13-15-32(16-14-28)45-39(41)42;3-2(4,5)1(6)7/h3-16,19-21,33H,17-18,23-24H2,1-2H3,(H,43,46)(H,44,48)(H4,41,42,45);(H,6,7)/t33-;/m1./s1 |
| InChIKey | YIGHCJDENWOSFX-MGDILKBHSA-N |
| XLogP | 5.11 |
| TPSA | 245.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.79 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|