C39H34N4O7 — CID 69144732
benzyl (4R)-5-[2-[(E)-2-acetamido-3-methoxy-3-oxoprop-1-enyl]-5-cyanophenoxy]-4-[[3-(4-cyanophenyl)benzoyl]amino]pentanoate (PubChem CID 69144732) has the molecular formula C39H34N4O7 and a molecular weight of 670.72 g/mol. Its IUPAC name is benzyl (4R)-5-[2-[(E)-2-acetamido-3-methoxy-3-oxoprop-1-enyl]-5-cyanophenoxy]-4-[[3-(4-cyanophenyl)benzoyl]amino]pentanoate.
| Compound Name | benzyl (4R)-5-[2-[(E)-2-acetamido-3-methoxy-3-oxoprop-1-enyl]-5-cyanophenoxy]-4-[[3-(4-cyanophenyl)benzoyl]amino]pentanoate |
|---|---|
| PubChem CID | 69144732 |
| Molecular Formula | C39H34N4O7 |
| Molecular Weight | 670.72 g/mol |
| Exact Mass | 670.24 |
| IUPAC Name | benzyl (4R)-5-[2-[(E)-2-acetamido-3-methoxy-3-oxoprop-1-enyl]-5-cyanophenoxy]-4-[[3-(4-cyanophenyl)benzoyl]amino]pentanoate |
| SMILES | COC(=O)/C(=C\c1ccc(C#N)cc1OC[C@@H](CCC(=O)OCc1ccccc1)NC(=O)c1cccc(-c2ccc(C#N)cc2)c1)NC(C)=O |
| InChI | InChI=1S/C39H34N4O7/c1-26(44)42-35(39(47)48-2)21-32-16-13-29(23-41)19-36(32)49-25-34(17-18-37(45)50-24-28-7-4-3-5-8-28)43-38(46)33-10-6-9-31(20-33)30-14-11-27(22-40)12-15-30/h3-16,19-21,34H,17-18,24-25H2,1-2H3,(H,42,44)(H,43,46)/b35-21+/t34-/m1/s1 |
| InChIKey | FADFYGMXRUHVCW-CJBXRMFZSA-N |
| XLogP | 5.45 |
| TPSA | 167.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.72 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|