C19H26FIN2O4 — CID 69144021
4-O-tert-butyl 1-O-[(2-fluoro-5-iodophenyl)methyl] (2R)-2-ethylpiperazine-1,4-dicarboxylate (PubChem CID 69144021) has the molecular formula C19H26FIN2O4 and a molecular weight of 492.33 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[(2-fluoro-5-iodophenyl)methyl] (2R)-2-ethylpiperazine-1,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 1-O-[(2-fluoro-5-iodophenyl)methyl] (2R)-2-ethylpiperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 69144021 |
| Molecular Formula | C19H26FIN2O4 |
| Molecular Weight | 492.33 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 4-O-tert-butyl 1-O-[(2-fluoro-5-iodophenyl)methyl] (2R)-2-ethylpiperazine-1,4-dicarboxylate |
| SMILES | CC[C@@H]1CN(C(=O)OC(C)(C)C)CCN1C(=O)OCc1cc(I)ccc1F |
| InChI | InChI=1S/C19H26FIN2O4/c1-5-15-11-22(17(24)27-19(2,3)4)8-9-23(15)18(25)26-12-13-10-14(21)6-7-16(13)20/h6-7,10,15H,5,8-9,11-12H2,1-4H3/t15-/m1/s1 |
| InChIKey | XFGRFJCJTPZHIS-OAHLLOKOSA-N |
| XLogP | 4.40 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|