C25H26N4O4 — CID 69146545
benzyl N-[(3S,4R)-3-[[4-(2-oxo-1-pyridinyl)benzoyl]amino]piperidin-4-yl]carbamate (PubChem CID 69146545) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is benzyl N-[(3S,4R)-3-[[4-(2-oxo-1-pyridinyl)benzoyl]amino]piperidin-4-yl]carbamate.
| Compound Name | benzyl N-[(3S,4R)-3-[[4-(2-oxo-1-pyridinyl)benzoyl]amino]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 69146545 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | benzyl N-[(3S,4R)-3-[[4-(2-oxo-1-pyridinyl)benzoyl]amino]piperidin-4-yl]carbamate |
| SMILES | O=C(N[C@@H]1CCNC[C@@H]1NC(=O)c1ccc(-n2ccccc2=O)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C25H26N4O4/c30-23-8-4-5-15-29(23)20-11-9-19(10-12-20)24(31)27-22-16-26-14-13-21(22)28-25(32)33-17-18-6-2-1-3-7-18/h1-12,15,21-22,26H,13-14,16-17H2,(H,27,31)(H,28,32)/t21-,22+/m1/s1 |
| InChIKey | VASOZBAEFPCKMB-YADHBBJMSA-N |
| XLogP | 2.22 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |