C30H36N4O3S — CID 69148790
(5-methylthiophen-2-yl) N-[3-[(3aS)-5-(2,4-dimethylpyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-methyl-1-phenylpropyl]carbamate (PubChem CID 69148790) has the molecular formula C30H36N4O3S and a molecular weight of 532.71 g/mol. Its IUPAC name is (5-methylthiophen-2-yl) N-[3-[(3aS)-5-(2,4-dimethylpyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-methyl-1-phenylpropyl]carbamate.
| Compound Name | (5-methylthiophen-2-yl) N-[3-[(3aS)-5-(2,4-dimethylpyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-methyl-1-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 69148790 |
| Molecular Formula | C30H36N4O3S |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | (5-methylthiophen-2-yl) N-[3-[(3aS)-5-(2,4-dimethylpyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-methyl-1-phenylpropyl]carbamate |
| SMILES | Cc1ccc(OC(=O)NC(c2ccccc2)C(C)CN2CC3CN(C(=O)c4c(C)ccnc4C)C[C@@H]3C2)s1 |
| InChI | InChI=1S/C30H36N4O3S/c1-19-12-13-31-22(4)27(19)29(35)34-17-24-15-33(16-25(24)18-34)14-20(2)28(23-8-6-5-7-9-23)32-30(36)37-26-11-10-21(3)38-26/h5-13,20,24-25,28H,14-18H2,1-4H3,(H,32,36)/t20?,24-,25?,28?/m0/s1 |
| InChIKey | FYXDKGLVEWIGJE-RMBWNNQASA-N |
| XLogP | 5.24 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |