C20H14ClF4N3O4 — CID 69154923
[(4R,6S)-6-(2-chloro-3-methoxyphenyl)-8-fluoro-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl] acetate (PubChem CID 69154923) has the molecular formula C20H14ClF4N3O4 and a molecular weight of 471.79 g/mol. Its IUPAC name is [(4R,6S)-6-(2-chloro-3-methoxyphenyl)-8-fluoro-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl] acetate.
| Compound Name | [(4R,6S)-6-(2-chloro-3-methoxyphenyl)-8-fluoro-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl] acetate |
|---|---|
| PubChem CID | 69154923 |
| Molecular Formula | C20H14ClF4N3O4 |
| Molecular Weight | 471.79 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | [(4R,6S)-6-(2-chloro-3-methoxyphenyl)-8-fluoro-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl] acetate |
| SMILES | COc1cccc([C@H]2O[C@H](OC(C)=O)c3nnc(C(F)(F)F)n3-c3ccc(F)cc32)c1Cl |
| InChI | InChI=1S/C20H14ClF4N3O4/c1-9(29)31-18-17-26-27-19(20(23,24)25)28(17)13-7-6-10(22)8-12(13)16(32-18)11-4-3-5-14(30-2)15(11)21/h3-8,16,18H,1-2H3/t16-,18+/m1/s1 |
| InChIKey | YGPZCIOYUFHXCQ-AEFFLSMTSA-N |
| XLogP | 4.77 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.79 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |