C29H26ClN5O4 — CID 69159060
ethyl 2-[2-[4-[4-(3-aminophenoxy)-3-chloroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]benzoate (PubChem CID 69159060) has the molecular formula C29H26ClN5O4 and a molecular weight of 544.01 g/mol. Its IUPAC name is ethyl 2-[2-[4-[4-(3-aminophenoxy)-3-chloroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]benzoate.
| Compound Name | ethyl 2-[2-[4-[4-(3-aminophenoxy)-3-chloroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]benzoate |
|---|---|
| PubChem CID | 69159060 |
| Molecular Formula | C29H26ClN5O4 |
| Molecular Weight | 544.01 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | ethyl 2-[2-[4-[4-(3-aminophenoxy)-3-chloroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]benzoate |
| SMILES | CCOC(=O)c1ccccc1OCCn1ccc2ncnc(Nc3ccc(Oc4cccc(N)c4)c(Cl)c3)c21 |
| InChI | InChI=1S/C29H26ClN5O4/c1-2-37-29(36)22-8-3-4-9-25(22)38-15-14-35-13-12-24-27(35)28(33-18-32-24)34-20-10-11-26(23(30)17-20)39-21-7-5-6-19(31)16-21/h3-13,16-18H,2,14-15,31H2,1H3,(H,32,33,34) |
| InChIKey | LHHZJSLOIMATGS-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.01 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|