C29H35Cl2N5O4 — CID 87535971
2-[2-[4-[4-[3-[(Z)-C-tert-butyl-N-ethoxycarbonimidoyl]phenoxy]-3-chloroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethanol;hydrochloride (PubChem CID 87535971) has the molecular formula C29H35Cl2N5O4 and a molecular weight of 588.54 g/mol. Its IUPAC name is 2-[2-[4-[4-[3-[(Z)-C-tert-butyl-N-ethoxycarbonimidoyl]phenoxy]-3-chloroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethanol;hydrochloride.
| Compound Name | 2-[2-[4-[4-[3-[(Z)-C-tert-butyl-N-ethoxycarbonimidoyl]phenoxy]-3-chloroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethanol;hydrochloride |
|---|---|
| PubChem CID | 87535971 |
| Molecular Formula | C29H35Cl2N5O4 |
| Molecular Weight | 588.54 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | 2-[2-[4-[4-[3-[(Z)-C-tert-butyl-N-ethoxycarbonimidoyl]phenoxy]-3-chloroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethanol;hydrochloride |
| SMILES | CCO/N=C(\c1cccc(Oc2ccc(Nc3ncnc4ccn(CCOCCO)c34)cc2Cl)c1)C(C)(C)C.Cl |
| InChI | InChI=1S/C29H34ClN5O4.ClH/c1-5-38-34-27(29(2,3)4)20-7-6-8-22(17-20)39-25-10-9-21(18-23(25)30)33-28-26-24(31-19-32-28)11-12-35(26)13-15-37-16-14-36;/h6-12,17-19,36H,5,13-16H2,1-4H3,(H,31,32,33);1H/b34-27+; |
| InChIKey | GBBGGTDPIQJQCA-SSCGHQBZSA-N |
| XLogP | 6.84 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.54 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|