C28H32ClN5O4 — CID 59453196
2-[2-[4-[4-[3-[(Z)-C-tert-butyl-N-methoxycarbonimidoyl]phenoxy]-3-chloroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethanol (PubChem CID 59453196) has the molecular formula C28H32ClN5O4 and a molecular weight of 538.05 g/mol. Its IUPAC name is 2-[2-[4-[4-[3-[(Z)-C-tert-butyl-N-methoxycarbonimidoyl]phenoxy]-3-chloroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethanol.
| Compound Name | 2-[2-[4-[4-[3-[(Z)-C-tert-butyl-N-methoxycarbonimidoyl]phenoxy]-3-chloroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 59453196 |
| Molecular Formula | C28H32ClN5O4 |
| Molecular Weight | 538.05 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 2-[2-[4-[4-[3-[(Z)-C-tert-butyl-N-methoxycarbonimidoyl]phenoxy]-3-chloroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethanol |
| SMILES | CO/N=C(\c1cccc(Oc2ccc(Nc3ncnc4ccn(CCOCCO)c34)cc2Cl)c1)C(C)(C)C |
| InChI | InChI=1S/C28H32ClN5O4/c1-28(2,3)26(33-36-4)19-6-5-7-21(16-19)38-24-9-8-20(17-22(24)29)32-27-25-23(30-18-31-27)10-11-34(25)12-14-37-15-13-35/h5-11,16-18,35H,12-15H2,1-4H3,(H,30,31,32)/b33-26+ |
| InChIKey | BAGORINVXNLXOF-MHTZHOPKSA-N |
| XLogP | 6.03 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.05 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|