C26H35ClN4O3 — CID 69161091
2-[2-[4-[4-(4-tert-butylcyclohexyl)oxy-3-chloroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethanol (PubChem CID 69161091) has the molecular formula C26H35ClN4O3 and a molecular weight of 487.04 g/mol. Its IUPAC name is 2-[2-[4-[4-(4-tert-butylcyclohexyl)oxy-3-chloroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethanol.
| Compound Name | 2-[2-[4-[4-(4-tert-butylcyclohexyl)oxy-3-chloroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 69161091 |
| Molecular Formula | C26H35ClN4O3 |
| Molecular Weight | 487.04 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 2-[2-[4-[4-(4-tert-butylcyclohexyl)oxy-3-chloroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethoxy]ethanol |
| SMILES | CC(C)(C)C1CCC(Oc2ccc(Nc3ncnc4ccn(CCOCCO)c34)cc2Cl)CC1 |
| InChI | InChI=1S/C26H35ClN4O3/c1-26(2,3)18-4-7-20(8-5-18)34-23-9-6-19(16-21(23)27)30-25-24-22(28-17-29-25)10-11-31(24)12-14-33-15-13-32/h6,9-11,16-18,20,32H,4-5,7-8,12-15H2,1-3H3,(H,28,29,30) |
| InChIKey | IPFKEIDMRWTUES-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.04 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|